Publicação
Spatial relationships between entomopathogenic nematodes and nematophagous fungi in Florida citrus orchards
| dc.contributor.author | Pathak, Ekta | |
| dc.contributor.author | Campos-Herrera, Raquel | |
| dc.contributor.author | El-Borai, Fahiem E. | |
| dc.contributor.author | Duncan, Larry W. | |
| dc.date.accessioned | 2019-11-20T15:07:45Z | |
| dc.date.available | 2019-11-20T15:07:45Z | |
| dc.date.issued | 2017-03 | |
| dc.description.abstract | Relationships between entomopathogenic nematodes (EPNs), nematophagous fungi (NF) and soil physical and chemical properties were studied in a survey of 53 citrus orchards in central ridge and flatwoods ecoregions of Florida. Seven species of NF associated with nematodes were quantified directly using a real time qPCR assay. All nematophagous fungi studied except Arthrobotrys musiformis and Hirsutella rhossiliensis were frequently detected (24-56%) in both regions. Paecilomyces lilacinus and Gamsylella gephyropagum were encountered more frequently in the flatwoods (P = 0.03) and on the ridge (P = 0.02), respectively. Redundancy analysis revealed seven abiotic and biotic factors as significantly related to the NF occurrence. Multiple regression of fungi on these variables explained 78%, 66%, 48%, 36%, 23% and 4% of the variation in Catenaria sp., A. musiformis, A dactyloides, P. lilacinus, A. oligospora and G. gepharopagum, respectively. When the data from citrus were pooled with those reported previously from natural areas and subjected to principle component analysis, the first two principle components explained 43% of the variation in NF communities. The surveys (citrus vs natural areas) were discriminated by PC2 (P < 0.001) and the ecoregion by PC1 (P < 0.002), and all but one NF species were related (P < 0.01) to one or both components. NF communities tended to have more species and greater diversity in the flatwoods, where EPN richness and diversity were the least. However, the strength of associations between individual EPN and NF species as measured by SADIE reflected the associations between each species and ground water depth, suggesting that ecoregion preferences affected the species associations. Within each ecoregion, significant relationships between the individual NF and EPN species measured by stepwise regression tended to be positive. The results did not support the hypothesis that NF modulate the spatial patterns of EPN species between or within these two ecoregions. (C) 2017 Elsevier Inc. All rights reserved. | |
| dc.description.sponsorship | USDA-CSREES Special Grant (TSTAR) | |
| dc.description.sponsorship | U.S-Egypt Science and Technology Joint Fund [338] | |
| dc.description.sponsorship | Ramon Areces Spanish Foundation | |
| dc.description.sponsorship | Marie Curie International Outgoing Fellowship within the 7th European Community Framework Programme [FP7-PEOPLE-2009-IOF-252980] | |
| dc.identifier.doi | 10.1016/j.jip.2017.01.005 | |
| dc.identifier.issn | 0022-2011 | |
| dc.identifier.issn | 1096-0805 | |
| dc.identifier.uri | http://hdl.handle.net/10400.1/13199 | |
| dc.language.iso | eng | |
| dc.peerreviewed | yes | |
| dc.publisher | Academic Press Inc Elsevier Science | |
| dc.relation | Molecular and ecological approaches to study soil food webs for enhancing biological control of insect pests and monitoring disturbances | |
| dc.subject | Real-Time Pcr | |
| dc.subject | Trapping Fungi | |
| dc.subject | Hirsutella-Rhossiliensis | |
| dc.subject | Arthrobotrys-Oligospora | |
| dc.subject | Criconemella-Xenoplax | |
| dc.subject | Catenaria-Anguillulae | |
| dc.subject | Soil Chytridiomycota | |
| dc.subject | Destroying Fungi | |
| dc.subject | Quantitative Pcr | |
| dc.subject | Grassland Soil | |
| dc.title | Spatial relationships between entomopathogenic nematodes and nematophagous fungi in Florida citrus orchards | |
| dc.type | journal article | |
| dspace.entity.type | Publication | |
| oaire.awardNumber | 252980 | |
| oaire.awardTitle | Molecular and ecological approaches to study soil food webs for enhancing biological control of insect pests and monitoring disturbances | |
| oaire.awardURI | info:eu-repo/grantAgreement/EC/FP7/252980/EU | |
| oaire.citation.endPage | 46 | |
| oaire.citation.startPage | 37 | |
| oaire.citation.title | Journal of Invertebrate Pathology | |
| oaire.citation.volume | 144 | |
| oaire.fundingStream | FP7 | |
| person.familyName | Campos-Herrera | |
| person.givenName | Raquel | |
| person.identifier | 75402 | |
| person.identifier.orcid | 0000-0003-0852-5269 | |
| person.identifier.rid | A-5299-2017 | |
| person.identifier.scopus-author-id | 16318511600 | |
| project.funder.identifier | http://doi.org/10.13039/501100008530 | |
| project.funder.name | European Commission | |
| rcaap.rights | restrictedAccess | |
| rcaap.type | article | |
| relation.isAuthorOfPublication | 28736fd2-ac4e-43ac-84e0-51a1a10ffc28 | |
| relation.isAuthorOfPublication.latestForDiscovery | 28736fd2-ac4e-43ac-84e0-51a1a10ffc28 | |
| relation.isProjectOfPublication | 41f1dae1-37c7-450e-8bce-4755ce04d587 | |
| relation.isProjectOfPublication.latestForDiscovery | 41f1dae1-37c7-450e-8bce-4755ce04d587 |
Ficheiros
Principais
1 - 1 de 1
A carregar...
- Nome:
- 13199 linha 35 - S0022201117300034.pdf
- Tamanho:
- 1.11 MB
- Formato:
- Adobe Portable Document Format
